C22H30O4 — CID 87319576
4-(2-ethylhexoxycarbonyl)penta-2,4-dienoic acid;styrene (PubChem CID 87319576) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 4-(2-ethylhexoxycarbonyl)penta-2,4-dienoic acid;styrene.
| Compound Name | 4-(2-ethylhexoxycarbonyl)penta-2,4-dienoic acid;styrene |
|---|---|
| PubChem CID | 87319576 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 4-(2-ethylhexoxycarbonyl)penta-2,4-dienoic acid;styrene |
| SMILES | C=C(C=CC(=O)O)C(=O)OCC(CC)CCCC.C=Cc1ccccc1 |
| InChI | InChI=1S/C14H22O4.C8H8/c1-4-6-7-12(5-2)10-18-14(17)11(3)8-9-13(15)16;1-2-8-6-4-3-5-7-8/h8-9,12H,3-7,10H2,1-2H3,(H,15,16);2-7H,1H2 |
| InChIKey | NCAFXVWSGKMGPD-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|