C26H39NO6S — CID 118321522
4-(2-ethylhexoxycarbonyl)-2-methyl-1-(prop-2-enoylamino)pent-4-ene-1-sulfonic acid;styrene (PubChem CID 118321522) has the molecular formula C26H39NO6S and a molecular weight of 493.67 g/mol. Its IUPAC name is 4-(2-ethylhexoxycarbonyl)-2-methyl-1-(prop-2-enoylamino)pent-4-ene-1-sulfonic acid;styrene.
| Compound Name | 4-(2-ethylhexoxycarbonyl)-2-methyl-1-(prop-2-enoylamino)pent-4-ene-1-sulfonic acid;styrene |
|---|---|
| PubChem CID | 118321522 |
| Molecular Formula | C26H39NO6S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.25 |
| IUPAC Name | 4-(2-ethylhexoxycarbonyl)-2-methyl-1-(prop-2-enoylamino)pent-4-ene-1-sulfonic acid;styrene |
| SMILES | C=CC(=O)NC(C(C)CC(=C)C(=O)OCC(CC)CCCC)S(=O)(=O)O.C=Cc1ccccc1 |
| InChI | InChI=1S/C18H31NO6S.C8H8/c1-6-9-10-15(7-2)12-25-18(21)14(5)11-13(4)17(26(22,23)24)19-16(20)8-3;1-2-8-6-4-3-5-7-8/h8,13,15,17H,3,5-7,9-12H2,1-2,4H3,(H,19,20)(H,22,23,24);2-7H,1H2 |
| InChIKey | FANIIYMAQKXOEL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|