2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate

C19H28O4 — CID 175186359

IUPAC2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate
SMILESCCCCC(CC)COC(=O)C(OC)=C(OC)c1ccccc1
InChIInChI=1S/C19H28O4/c1-5-7-11-15(6-2)14-23-19(20)18(22-4)17(21-3)16-12-9-8-10-13-16/h8-10,12-13,15H,5-7,11,14H2,1-4H3
InChIKeyYLDKGJXCVCEFBP-UHFFFAOYSA-N
MW320.43 g/mol
LogP4.41
Rot. Bonds10

About 2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate

2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate (PubChem CID 175186359) has the molecular formula C19H28O4 and a molecular weight of 320.43 g/mol. Its IUPAC name is 2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate.

Molecular Properties

Compound Name2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate
PubChem CID175186359
Molecular FormulaC19H28O4
Molecular Weight320.43 g/mol
Exact Mass320.20
IUPAC Name2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate
SMILESCCCCC(CC)COC(=O)C(OC)=C(OC)c1ccccc1
InChIInChI=1S/C19H28O4/c1-5-7-11-15(6-2)14-23-19(20)18(22-4)17(21-3)16-12-9-8-10-13-16/h8-10,12-13,15H,5-7,11,14H2,1-4H3
InChIKeyYLDKGJXCVCEFBP-UHFFFAOYSA-N
XLogP4.41
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms23
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500320.43
LogP ≤ 54.41
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate?
The IUPAC name of 2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate (CID 175186359) is 2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate.
What is the SMILES notation for 2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate?
The canonical SMILES for 2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate is CCCCC(CC)COC(=O)C(OC)=C(OC)c1ccccc1.
What is the InChIKey of 2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate?
The InChIKey is YLDKGJXCVCEFBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28O4/c1-5-7-11-15(6-2)14-23-19(20)18(22-4)17(21-3)16-12-9-8-10-13-16/h8-10,12-13,15H,5-7,11,14H2,1-4H3.
What are the key properties of 2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate?
2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate has a molecular weight of 320.43 g/mol, XLogP of 4.41, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 2,3-dimethoxy-3-phenylprop-2-enoate is sourced from PubChem (CID 175186359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).