C34H34O3 — CID 118478540
2-ethylhexyl 2-[4-(4-phenylphenyl)benzoyl]benzoate (PubChem CID 118478540) has the molecular formula C34H34O3 and a molecular weight of 490.64 g/mol. Its IUPAC name is 2-ethylhexyl 2-[4-(4-phenylphenyl)benzoyl]benzoate.
| Compound Name | 2-ethylhexyl 2-[4-(4-phenylphenyl)benzoyl]benzoate |
|---|---|
| PubChem CID | 118478540 |
| Molecular Formula | C34H34O3 |
| Molecular Weight | 490.64 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 2-ethylhexyl 2-[4-(4-phenylphenyl)benzoyl]benzoate |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1C(=O)c1ccc(-c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C34H34O3/c1-3-5-11-25(4-2)24-37-34(36)32-15-10-9-14-31(32)33(35)30-22-20-29(21-23-30)28-18-16-27(17-19-28)26-12-7-6-8-13-26/h6-10,12-23,25H,3-5,11,24H2,1-2H3 |
| InChIKey | HIKIKDXVGZFIRN-UHFFFAOYSA-N |
| XLogP | 8.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.64 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |