C33H56O4 — CID 44589518
1-O-(2-ethyldecyl) 2-O-(2-ethylundecyl) benzene-1,2-dicarboxylate (PubChem CID 44589518) has the molecular formula C33H56O4 and a molecular weight of 516.81 g/mol. Its IUPAC name is 1-O-(2-ethyldecyl) 2-O-(2-ethylundecyl) benzene-1,2-dicarboxylate.
| Compound Name | 1-O-(2-ethyldecyl) 2-O-(2-ethylundecyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 44589518 |
| Molecular Formula | C33H56O4 |
| Molecular Weight | 516.81 g/mol |
| Exact Mass | 516.42 |
| IUPAC Name | 1-O-(2-ethyldecyl) 2-O-(2-ethylundecyl) benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCCCCCC |
| InChI | InChI=1S/C33H56O4/c1-5-9-11-13-15-17-19-23-29(8-4)27-37-33(35)31-25-21-20-24-30(31)32(34)36-26-28(7-3)22-18-16-14-12-10-6-2/h20-21,24-25,28-29H,5-19,22-23,26-27H2,1-4H3 |
| InChIKey | NGQVOKWWBHQUJB-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.81 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|