C30H42Cl2O4 — CID 67686577
bis(2-ethylhexyl) benzene-1,2-dicarboxylate;1,2-dichlorobenzene (PubChem CID 67686577) has the molecular formula C30H42Cl2O4 and a molecular weight of 537.57 g/mol. Its IUPAC name is bis(2-ethylhexyl) benzene-1,2-dicarboxylate;1,2-dichlorobenzene.
| Compound Name | bis(2-ethylhexyl) benzene-1,2-dicarboxylate;1,2-dichlorobenzene |
|---|---|
| PubChem CID | 67686577 |
| Molecular Formula | C30H42Cl2O4 |
| Molecular Weight | 537.57 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | bis(2-ethylhexyl) benzene-1,2-dicarboxylate;1,2-dichlorobenzene |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCC.Clc1ccccc1Cl |
| InChI | InChI=1S/C24H38O4.C6H4Cl2/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2;7-5-3-1-2-4-6(5)8/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3;1-4H |
| InChIKey | UJUFPDSOSRJWQU-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.57 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |