C22H26O5 — CID 146469755
[2-(2-ethylhexoxycarbonyl)phenyl] 2-hydroxybenzoate (PubChem CID 146469755) has the molecular formula C22H26O5 and a molecular weight of 370.45 g/mol. Its IUPAC name is [2-(2-ethylhexoxycarbonyl)phenyl] 2-hydroxybenzoate.
| Compound Name | [2-(2-ethylhexoxycarbonyl)phenyl] 2-hydroxybenzoate |
|---|---|
| PubChem CID | 146469755 |
| Molecular Formula | C22H26O5 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [2-(2-ethylhexoxycarbonyl)phenyl] 2-hydroxybenzoate |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1OC(=O)c1ccccc1O |
| InChI | InChI=1S/C22H26O5/c1-3-5-10-16(4-2)15-26-21(24)18-12-7-9-14-20(18)27-22(25)17-11-6-8-13-19(17)23/h6-9,11-14,16,23H,3-5,10,15H2,1-2H3 |
| InChIKey | ORTWCXLYTIXVCY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|