C30H46O8 — CID 50905906
4-O,5-O-diethyl 1-O,2-O-bis(2-ethylhexyl) benzene-1,2,4,5-tetracarboxylate (PubChem CID 50905906) has the molecular formula C30H46O8 and a molecular weight of 534.69 g/mol. Its IUPAC name is 4-O,5-O-diethyl 1-O,2-O-bis(2-ethylhexyl) benzene-1,2,4,5-tetracarboxylate.
| Compound Name | 4-O,5-O-diethyl 1-O,2-O-bis(2-ethylhexyl) benzene-1,2,4,5-tetracarboxylate |
|---|---|
| PubChem CID | 50905906 |
| Molecular Formula | C30H46O8 |
| Molecular Weight | 534.69 g/mol |
| Exact Mass | 534.32 |
| IUPAC Name | 4-O,5-O-diethyl 1-O,2-O-bis(2-ethylhexyl) benzene-1,2,4,5-tetracarboxylate |
| SMILES | CCCCC(CC)COC(=O)c1cc(C(=O)OCC)c(C(=O)OCC)cc1C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C30H46O8/c1-7-13-15-21(9-3)19-37-29(33)25-17-23(27(31)35-11-5)24(28(32)36-12-6)18-26(25)30(34)38-20-22(10-4)16-14-8-2/h17-18,21-22H,7-16,19-20H2,1-6H3 |
| InChIKey | NEVDBIUNQTZWEC-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.69 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|