C18H22O8 — CID 141451805
4-(2-ethylhexoxycarbonyl)benzene-1,2,3-tricarboxylic acid (PubChem CID 141451805) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is 4-(2-ethylhexoxycarbonyl)benzene-1,2,3-tricarboxylic acid.
| Compound Name | 4-(2-ethylhexoxycarbonyl)benzene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 141451805 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 4-(2-ethylhexoxycarbonyl)benzene-1,2,3-tricarboxylic acid |
| SMILES | CCCCC(CC)COC(=O)c1ccc(C(=O)O)c(C(=O)O)c1C(=O)O |
| InChI | InChI=1S/C18H22O8/c1-3-5-6-10(4-2)9-26-18(25)12-8-7-11(15(19)20)13(16(21)22)14(12)17(23)24/h7-8,10H,3-6,9H2,1-2H3,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | NJTRVCBAPWXZBV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |