C34H54O8 — CID 141011156
2,3,4-tris(2-ethylhexoxycarbonyl)benzoic acid (PubChem CID 141011156) has the molecular formula C34H54O8 and a molecular weight of 590.80 g/mol. Its IUPAC name is 2,3,4-tris(2-ethylhexoxycarbonyl)benzoic acid.
| Compound Name | 2,3,4-tris(2-ethylhexoxycarbonyl)benzoic acid |
|---|---|
| PubChem CID | 141011156 |
| Molecular Formula | C34H54O8 |
| Molecular Weight | 590.80 g/mol |
| Exact Mass | 590.38 |
| IUPAC Name | 2,3,4-tris(2-ethylhexoxycarbonyl)benzoic acid |
| SMILES | CCCCC(CC)COC(=O)c1ccc(C(=O)O)c(C(=O)OCC(CC)CCCC)c1C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C34H54O8/c1-7-13-16-24(10-4)21-40-32(37)28-20-19-27(31(35)36)29(33(38)41-22-25(11-5)17-14-8-2)30(28)34(39)42-23-26(12-6)18-15-9-3/h19-20,24-26H,7-18,21-23H2,1-6H3,(H,35,36) |
| InChIKey | AHGGAZJOVHSWCZ-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.80 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|