C48H74O8 — CID 139855031
tetrakis(2-ethylhexyl) 5-phenylbenzene-1,2,3,4-tetracarboxylate (PubChem CID 139855031) has the molecular formula C48H74O8 and a molecular weight of 779.11 g/mol. Its IUPAC name is tetrakis(2-ethylhexyl) 5-phenylbenzene-1,2,3,4-tetracarboxylate.
| Compound Name | tetrakis(2-ethylhexyl) 5-phenylbenzene-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 139855031 |
| Molecular Formula | C48H74O8 |
| Molecular Weight | 779.11 g/mol |
| Exact Mass | 778.54 |
| IUPAC Name | tetrakis(2-ethylhexyl) 5-phenylbenzene-1,2,3,4-tetracarboxylate |
| SMILES | CCCCC(CC)COC(=O)c1cc(-c2ccccc2)c(C(=O)OCC(CC)CCCC)c(C(=O)OCC(CC)CCCC)c1C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C48H74O8/c1-9-17-24-35(13-5)31-53-45(49)41-30-40(39-28-22-21-23-29-39)42(46(50)54-32-36(14-6)25-18-10-2)44(48(52)56-34-38(16-8)27-20-12-4)43(41)47(51)55-33-37(15-7)26-19-11-3/h21-23,28-30,35-38H,9-20,24-27,31-34H2,1-8H3 |
| InChIKey | HFMCEXPNFDSMJY-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.11 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|