C60H84O9 — CID 88696802
1,1'-biphenyl;bis(2-ethylhexyl) 4-[3,4-bis(2-ethylhexoxycarbonyl)phenyl]-2-hydroxybenzene-1,3-dicarboxylate (PubChem CID 88696802) has the molecular formula C60H84O9 and a molecular weight of 949.32 g/mol. Its IUPAC name is 1,1'-biphenyl;bis(2-ethylhexyl) 4-[3,4-bis(2-ethylhexoxycarbonyl)phenyl]-2-hydroxybenzene-1,3-dicarboxylate.
| Compound Name | 1,1'-biphenyl;bis(2-ethylhexyl) 4-[3,4-bis(2-ethylhexoxycarbonyl)phenyl]-2-hydroxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 88696802 |
| Molecular Formula | C60H84O9 |
| Molecular Weight | 949.32 g/mol |
| Exact Mass | 948.61 |
| IUPAC Name | 1,1'-biphenyl;bis(2-ethylhexyl) 4-[3,4-bis(2-ethylhexoxycarbonyl)phenyl]-2-hydroxybenzene-1,3-dicarboxylate |
| SMILES | CCCCC(CC)COC(=O)c1ccc(-c2ccc(C(=O)OCC(CC)CCCC)c(O)c2C(=O)OCC(CC)CCCC)cc1C(=O)OCC(CC)CCCC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C48H74O9.C12H10/c1-9-17-21-34(13-5)30-54-45(50)40-26-25-38(29-42(40)47(52)56-32-36(15-7)23-19-11-3)39-27-28-41(46(51)55-31-35(14-6)22-18-10-2)44(49)43(39)48(53)57-33-37(16-8)24-20-12-4;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h25-29,34-37,49H,9-24,30-33H2,1-8H3;1-10H |
| InChIKey | PDAQNWZVLCCDRS-UHFFFAOYSA-N |
| XLogP | 15.91 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 949.32 |
| LogP ≤ 5 | 15.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|