C28H50O4Si — CID 67644728
bis(2-ethylhexyl) benzene-1,2-dicarboxylate;tetramethylsilane (PubChem CID 67644728) has the molecular formula C28H50O4Si and a molecular weight of 478.79 g/mol. Its IUPAC name is bis(2-ethylhexyl) benzene-1,2-dicarboxylate;tetramethylsilane.
| Compound Name | bis(2-ethylhexyl) benzene-1,2-dicarboxylate;tetramethylsilane |
|---|---|
| PubChem CID | 67644728 |
| Molecular Formula | C28H50O4Si |
| Molecular Weight | 478.79 g/mol |
| Exact Mass | 478.35 |
| IUPAC Name | bis(2-ethylhexyl) benzene-1,2-dicarboxylate;tetramethylsilane |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCC.C[Si](C)(C)C |
| InChI | InChI=1S/C24H38O4.C4H12Si/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2;1-5(2,3)4/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3;1-4H3 |
| InChIKey | TUVLVTQXAKMYME-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.79 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|