C29H48O9 — CID 67524361
bis(2-ethylhexyl) benzene-1,2-dicarboxylate;(3R,4S,5R)-oxane-2,3,4,5-tetrol (PubChem CID 67524361) has the molecular formula C29H48O9 and a molecular weight of 540.69 g/mol. Its IUPAC name is bis(2-ethylhexyl) benzene-1,2-dicarboxylate;(3R,4S,5R)-oxane-2,3,4,5-tetrol.
| Compound Name | bis(2-ethylhexyl) benzene-1,2-dicarboxylate;(3R,4S,5R)-oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 67524361 |
| Molecular Formula | C29H48O9 |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.33 |
| IUPAC Name | bis(2-ethylhexyl) benzene-1,2-dicarboxylate;(3R,4S,5R)-oxane-2,3,4,5-tetrol |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1C(=O)OCC(CC)CCCC.OC1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C24H38O4.C5H10O5/c1-5-9-13-19(7-3)17-27-23(25)21-15-11-12-16-22(21)24(26)28-18-20(8-4)14-10-6-2;6-2-1-10-5(9)4(8)3(2)7/h11-12,15-16,19-20H,5-10,13-14,17-18H2,1-4H3;2-9H,1H2/t;2-,3+,4-,5?/m.1/s1 |
| InChIKey | ZASWGZHPVPAOMJ-HWQQROTDSA-N |
| XLogP | 3.85 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |