C64H92O9 — CID 88696688
1,1'-biphenyl;dinonyl 4-[3,4-bis(nonoxycarbonyl)phenyl]-2-hydroxybenzene-1,3-dicarboxylate (PubChem CID 88696688) has the molecular formula C64H92O9 and a molecular weight of 1005.43 g/mol. Its IUPAC name is 1,1'-biphenyl;dinonyl 4-[3,4-bis(nonoxycarbonyl)phenyl]-2-hydroxybenzene-1,3-dicarboxylate.
| Compound Name | 1,1'-biphenyl;dinonyl 4-[3,4-bis(nonoxycarbonyl)phenyl]-2-hydroxybenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 88696688 |
| Molecular Formula | C64H92O9 |
| Molecular Weight | 1005.43 g/mol |
| Exact Mass | 1004.67 |
| IUPAC Name | 1,1'-biphenyl;dinonyl 4-[3,4-bis(nonoxycarbonyl)phenyl]-2-hydroxybenzene-1,3-dicarboxylate |
| SMILES | CCCCCCCCCOC(=O)c1ccc(-c2ccc(C(=O)OCCCCCCCCC)c(O)c2C(=O)OCCCCCCCCC)cc1C(=O)OCCCCCCCCC.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C52H82O9.C12H10/c1-5-9-13-17-21-25-29-37-58-49(54)44-34-33-42(41-46(44)51(56)60-39-31-27-23-19-15-11-7-3)43-35-36-45(50(55)59-38-30-26-22-18-14-10-6-2)48(53)47(43)52(57)61-40-32-28-24-20-16-12-8-4;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h33-36,41,53H,5-32,37-40H2,1-4H3;1-10H |
| InChIKey | ULPXKAILOHCMBT-UHFFFAOYSA-N |
| XLogP | 18.04 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1005.43 |
| LogP ≤ 5 | 18.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|