C44H66O8 — CID 101318453
2-O-heptyl 1-O-(2-methylhexyl) 3-[4-heptoxycarbonyl-3-(2-methylhexoxycarbonyl)phenyl]benzene-1,2-dicarboxylate (PubChem CID 101318453) has the molecular formula C44H66O8 and a molecular weight of 723.00 g/mol. Its IUPAC name is 2-O-heptyl 1-O-(2-methylhexyl) 3-[4-heptoxycarbonyl-3-(2-methylhexoxycarbonyl)phenyl]benzene-1,2-dicarboxylate.
| Compound Name | 2-O-heptyl 1-O-(2-methylhexyl) 3-[4-heptoxycarbonyl-3-(2-methylhexoxycarbonyl)phenyl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 101318453 |
| Molecular Formula | C44H66O8 |
| Molecular Weight | 723.00 g/mol |
| Exact Mass | 722.48 |
| IUPAC Name | 2-O-heptyl 1-O-(2-methylhexyl) 3-[4-heptoxycarbonyl-3-(2-methylhexoxycarbonyl)phenyl]benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCOC(=O)c1ccc(-c2cccc(C(=O)OCC(C)CCCC)c2C(=O)OCCCCCCC)cc1C(=O)OCC(C)CCCC |
| InChI | InChI=1S/C44H66O8/c1-7-11-15-17-19-28-49-41(45)37-27-26-35(30-39(37)43(47)52-32-34(6)23-14-10-4)36-24-21-25-38(42(46)51-31-33(5)22-13-9-3)40(36)44(48)50-29-20-18-16-12-8-2/h21,24-27,30,33-34H,7-20,22-23,28-29,31-32H2,1-6H3 |
| InChIKey | RKMJLIKDEPDOAC-UHFFFAOYSA-N |
| XLogP | 11.57 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.00 |
| LogP ≤ 5 | 11.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|