C58H94O8 — CID 88697205
didecyl 4-[3-decoxycarbonyl-2-(1-decoxy-1-oxopropan-2-yl)phenyl]benzene-1,2-dicarboxylate (PubChem CID 88697205) has the molecular formula C58H94O8 and a molecular weight of 919.38 g/mol. Its IUPAC name is didecyl 4-[3-decoxycarbonyl-2-(1-decoxy-1-oxopropan-2-yl)phenyl]benzene-1,2-dicarboxylate.
| Compound Name | didecyl 4-[3-decoxycarbonyl-2-(1-decoxy-1-oxopropan-2-yl)phenyl]benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 88697205 |
| Molecular Formula | C58H94O8 |
| Molecular Weight | 919.38 g/mol |
| Exact Mass | 918.69 |
| IUPAC Name | didecyl 4-[3-decoxycarbonyl-2-(1-decoxy-1-oxopropan-2-yl)phenyl]benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCCCOC(=O)c1ccc(-c2cccc(C(=O)OCCCCCCCCCC)c2C(C)C(=O)OCCCCCCCCCC)cc1C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C58H94O8/c1-6-10-14-18-22-26-30-34-43-63-55(59)48(5)54-50(39-38-40-52(54)57(61)65-45-36-32-28-24-20-16-12-8-3)49-41-42-51(56(60)64-44-35-31-27-23-19-15-11-7-2)53(47-49)58(62)66-46-37-33-29-25-21-17-13-9-4/h38-42,47-48H,6-37,43-46H2,1-5H3 |
| InChIKey | OUHQUXRZDALAQR-UHFFFAOYSA-N |
| XLogP | 17.03 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.38 |
| LogP ≤ 5 | 17.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|