C36H46O4 — CID 139981286
dioctyl 3-(2-phenylphenyl)benzene-1,2-dicarboxylate (PubChem CID 139981286) has the molecular formula C36H46O4 and a molecular weight of 542.76 g/mol. Its IUPAC name is dioctyl 3-(2-phenylphenyl)benzene-1,2-dicarboxylate.
| Compound Name | dioctyl 3-(2-phenylphenyl)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 139981286 |
| Molecular Formula | C36H46O4 |
| Molecular Weight | 542.76 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | dioctyl 3-(2-phenylphenyl)benzene-1,2-dicarboxylate |
| SMILES | CCCCCCCCOC(=O)c1cccc(-c2ccccc2-c2ccccc2)c1C(=O)OCCCCCCCC |
| InChI | InChI=1S/C36H46O4/c1-3-5-7-9-11-18-27-39-35(37)33-26-20-25-32(34(33)36(38)40-28-19-12-10-8-6-4-2)31-24-17-16-23-30(31)29-21-14-13-15-22-29/h13-17,20-26H,3-12,18-19,27-28H2,1-2H3 |
| InChIKey | TUOVKMFWHNBQQI-UHFFFAOYSA-N |
| XLogP | 10.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.76 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|