C32H46O4 — CID 141439530
bis(5,5-dimethylheptyl) 3-phenylbenzene-1,2-dicarboxylate (PubChem CID 141439530) has the molecular formula C32H46O4 and a molecular weight of 494.72 g/mol. Its IUPAC name is bis(5,5-dimethylheptyl) 3-phenylbenzene-1,2-dicarboxylate.
| Compound Name | bis(5,5-dimethylheptyl) 3-phenylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 141439530 |
| Molecular Formula | C32H46O4 |
| Molecular Weight | 494.72 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | bis(5,5-dimethylheptyl) 3-phenylbenzene-1,2-dicarboxylate |
| SMILES | CCC(C)(C)CCCCOC(=O)c1cccc(-c2ccccc2)c1C(=O)OCCCCC(C)(C)CC |
| InChI | InChI=1S/C32H46O4/c1-7-31(3,4)21-12-14-23-35-29(33)27-20-16-19-26(25-17-10-9-11-18-25)28(27)30(34)36-24-15-13-22-32(5,6)8-2/h9-11,16-20H,7-8,12-15,21-24H2,1-6H3 |
| InChIKey | RQGICYFVDVZFHN-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.72 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|