C30H42O4 — CID 141439516
bis(3,3-dimethylhexyl) 3-phenylbenzene-1,2-dicarboxylate (PubChem CID 141439516) has the molecular formula C30H42O4 and a molecular weight of 466.66 g/mol. Its IUPAC name is bis(3,3-dimethylhexyl) 3-phenylbenzene-1,2-dicarboxylate.
| Compound Name | bis(3,3-dimethylhexyl) 3-phenylbenzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 141439516 |
| Molecular Formula | C30H42O4 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.31 |
| IUPAC Name | bis(3,3-dimethylhexyl) 3-phenylbenzene-1,2-dicarboxylate |
| SMILES | CCCC(C)(C)CCOC(=O)c1cccc(-c2ccccc2)c1C(=O)OCCC(C)(C)CCC |
| InChI | InChI=1S/C30H42O4/c1-7-17-29(3,4)19-21-33-27(31)25-16-12-15-24(23-13-10-9-11-14-23)26(25)28(32)34-22-20-30(5,6)18-8-2/h9-16H,7-8,17-22H2,1-6H3 |
| InChIKey | NYORZSJEDLZSFL-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |