C19H20O3 — CID 955183
(3,3-dimethyl-2-oxobutyl) 2-phenylbenzoate (PubChem CID 955183) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-phenylbenzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-phenylbenzoate |
|---|---|
| PubChem CID | 955183 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-phenylbenzoate |
| SMILES | CC(C)(C)C(=O)COC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C19H20O3/c1-19(2,3)17(20)13-22-18(21)16-12-8-7-11-15(16)14-9-5-4-6-10-14/h4-12H,13H2,1-3H3 |
| InChIKey | HFXRNMPAFCJEEW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |