C17H24N2O4 — CID 17470932
(3,3-dimethyl-2-oxobutyl) 2-(propan-2-ylcarbamoylamino)benzoate (PubChem CID 17470932) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is (3,3-dimethyl-2-oxobutyl) 2-(propan-2-ylcarbamoylamino)benzoate.
| Compound Name | (3,3-dimethyl-2-oxobutyl) 2-(propan-2-ylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 17470932 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | (3,3-dimethyl-2-oxobutyl) 2-(propan-2-ylcarbamoylamino)benzoate |
| SMILES | CC(C)NC(=O)Nc1ccccc1C(=O)OCC(=O)C(C)(C)C |
| InChI | InChI=1S/C17H24N2O4/c1-11(2)18-16(22)19-13-9-7-6-8-12(13)15(21)23-10-14(20)17(3,4)5/h6-9,11H,10H2,1-5H3,(H2,18,19,22) |
| InChIKey | RGXJYZJOVHXHIX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |