C20H22ClN3O4 — CID 55405291
[2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(propan-2-ylcarbamoylamino)benzoate (PubChem CID 55405291) has the molecular formula C20H22ClN3O4 and a molecular weight of 403.87 g/mol. Its IUPAC name is [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(propan-2-ylcarbamoylamino)benzoate.
| Compound Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(propan-2-ylcarbamoylamino)benzoate |
|---|---|
| PubChem CID | 55405291 |
| Molecular Formula | C20H22ClN3O4 |
| Molecular Weight | 403.87 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | [2-[(4-chlorophenyl)methylamino]-2-oxoethyl] 2-(propan-2-ylcarbamoylamino)benzoate |
| SMILES | CC(C)NC(=O)Nc1ccccc1C(=O)OCC(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H22ClN3O4/c1-13(2)23-20(27)24-17-6-4-3-5-16(17)19(26)28-12-18(25)22-11-14-7-9-15(21)10-8-14/h3-10,13H,11-12H2,1-2H3,(H,22,25)(H2,23,24,27) |
| InChIKey | MAZABEPDBYQZEL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.87 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |