C17H15ClN2O4 — CID 108507696
methyl 2-[[2-[(4-chlorophenyl)methylamino]-2-oxoacetyl]amino]benzoate (PubChem CID 108507696) has the molecular formula C17H15ClN2O4 and a molecular weight of 346.77 g/mol. Its IUPAC name is methyl 2-[[2-[(4-chlorophenyl)methylamino]-2-oxoacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[(4-chlorophenyl)methylamino]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108507696 |
| Molecular Formula | C17H15ClN2O4 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | methyl 2-[[2-[(4-chlorophenyl)methylamino]-2-oxoacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClN2O4/c1-24-17(23)13-4-2-3-5-14(13)20-16(22)15(21)19-10-11-6-8-12(18)9-7-11/h2-9H,10H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | USSCFNUPLJNXDN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|