C12H14N2O5 — CID 108512450
methyl 2-[[2-(2-hydroxyethylamino)-2-oxoacetyl]amino]benzoate (PubChem CID 108512450) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is methyl 2-[[2-(2-hydroxyethylamino)-2-oxoacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(2-hydroxyethylamino)-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108512450 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | methyl 2-[[2-(2-hydroxyethylamino)-2-oxoacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C(=O)NCCO |
| InChI | InChI=1S/C12H14N2O5/c1-19-12(18)8-4-2-3-5-9(8)14-11(17)10(16)13-6-7-15/h2-5,15H,6-7H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | QCCWBAVICVFZBK-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|