C11H12N2O5 — CID 4026783
2-[[2-(2-hydroxyethylamino)-2-oxoacetyl]amino]benzoic acid (PubChem CID 4026783) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is 2-[[2-(2-hydroxyethylamino)-2-oxoacetyl]amino]benzoic acid.
| Compound Name | 2-[[2-(2-hydroxyethylamino)-2-oxoacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 4026783 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 2-[[2-(2-hydroxyethylamino)-2-oxoacetyl]amino]benzoic acid |
| SMILES | O=C(NCCO)C(=O)Nc1ccccc1C(=O)O |
| InChI | InChI=1S/C11H12N2O5/c14-6-5-12-9(15)10(16)13-8-4-2-1-3-7(8)11(17)18/h1-4,14H,5-6H2,(H,12,15)(H,13,16)(H,17,18) |
| InChIKey | UWSYMQDGFUESJS-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|