C13H17N3O5 — CID 108524308
N'-(2-carbamoylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide (PubChem CID 108524308) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is N'-(2-carbamoylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide.
| Compound Name | N'-(2-carbamoylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide |
|---|---|
| PubChem CID | 108524308 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N'-(2-carbamoylphenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide |
| SMILES | NC(=O)c1ccccc1NC(=O)C(=O)NCCOCCO |
| InChI | InChI=1S/C13H17N3O5/c14-11(18)9-3-1-2-4-10(9)16-13(20)12(19)15-5-7-21-8-6-17/h1-4,17H,5-8H2,(H2,14,18)(H,15,19)(H,16,20) |
| InChIKey | YDQSDRHQRVDGCS-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|