C18H21N3O4 — CID 108524269
N'-(4-anilinophenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide (PubChem CID 108524269) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N'-(4-anilinophenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide.
| Compound Name | N'-(4-anilinophenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide |
|---|---|
| PubChem CID | 108524269 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N'-(4-anilinophenyl)-N-[2-(2-hydroxyethoxy)ethyl]oxamide |
| SMILES | O=C(NCCOCCO)C(=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C18H21N3O4/c22-11-13-25-12-10-19-17(23)18(24)21-16-8-6-15(7-9-16)20-14-4-2-1-3-5-14/h1-9,20,22H,10-13H2,(H,19,23)(H,21,24) |
| InChIKey | QMROYCDPDMHGBY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|