About N-butyl-N'-phenyloxamide
N-butyl-N'-phenyloxamide (PubChem CID 2290889) has the molecular formula C12H16N2O2
and a molecular weight of 220.27 g/mol. Its IUPAC name is N-butyl-N'-phenyloxamide.
Molecular Properties
| Compound Name | N-butyl-N'-phenyloxamide |
| PubChem CID | 2290889 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-butyl-N'-phenyloxamide |
| SMILES | CCCCNC(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C12H16N2O2/c1-2-3-9-13-11(15)12(16)14-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | MRHKKYHZHICHIC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N'-phenyloxamide?
The IUPAC name of N-butyl-N'-phenyloxamide (CID 2290889) is N-butyl-N'-phenyloxamide.
What is the SMILES notation for N-butyl-N'-phenyloxamide?
The canonical SMILES for N-butyl-N'-phenyloxamide is CCCCNC(=O)C(=O)Nc1ccccc1.
What is the InChIKey of N-butyl-N'-phenyloxamide?
The InChIKey is MRHKKYHZHICHIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O2/c1-2-3-9-13-11(15)12(16)14-10-7-5-4-6-8-10/h4-8H,2-3,9H2,1H3,(H,13,15)(H,14,16).
What are the key properties of N-butyl-N'-phenyloxamide?
N-butyl-N'-phenyloxamide has a molecular weight of 220.27 g/mol, XLogP of 1.54, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N'-phenyloxamide is sourced from PubChem (CID 2290889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).