About N'-phenyl-N-propyloxamide
N'-phenyl-N-propyloxamide (PubChem CID 2291438) has the molecular formula C11H14N2O2
and a molecular weight of 206.25 g/mol. Its IUPAC name is N'-phenyl-N-propyloxamide.
Molecular Properties
| Compound Name | N'-phenyl-N-propyloxamide |
| PubChem CID | 2291438 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | N'-phenyl-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H14N2O2/c1-2-8-12-10(14)11(15)13-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | ROODIZBMLPFZFH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-phenyl-N-propyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-phenyl-N-propyloxamide?
The IUPAC name of N'-phenyl-N-propyloxamide (CID 2291438) is N'-phenyl-N-propyloxamide.
What is the SMILES notation for N'-phenyl-N-propyloxamide?
The canonical SMILES for N'-phenyl-N-propyloxamide is CCCNC(=O)C(=O)Nc1ccccc1.
What is the InChIKey of N'-phenyl-N-propyloxamide?
The InChIKey is ROODIZBMLPFZFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-2-8-12-10(14)11(15)13-9-6-4-3-5-7-9/h3-7H,2,8H2,1H3,(H,12,14)(H,13,15).
What are the key properties of N'-phenyl-N-propyloxamide?
N'-phenyl-N-propyloxamide has a molecular weight of 206.25 g/mol, XLogP of 1.15, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-phenyl-N-propyloxamide is sourced from PubChem (CID 2291438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).