C14H20N2O3 — CID 111461297
N-(3-hydroxy-4-methylpentyl)-N'-phenyloxamide (PubChem CID 111461297) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N-(3-hydroxy-4-methylpentyl)-N'-phenyloxamide.
| Compound Name | N-(3-hydroxy-4-methylpentyl)-N'-phenyloxamide |
|---|---|
| PubChem CID | 111461297 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-(3-hydroxy-4-methylpentyl)-N'-phenyloxamide |
| SMILES | CC(C)C(O)CCNC(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H20N2O3/c1-10(2)12(17)8-9-15-13(18)14(19)16-11-6-4-3-5-7-11/h3-7,10,12,17H,8-9H2,1-2H3,(H,15,18)(H,16,19) |
| InChIKey | HCOXWSQHVXMSJL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|