C15H16N2O4 — CID 97106351
N-[(3R)-3-(furan-3-yl)-3-hydroxypropyl]-N'-phenyloxamide (PubChem CID 97106351) has the molecular formula C15H16N2O4 and a molecular weight of 288.30 g/mol. Its IUPAC name is N-[(3R)-3-(furan-3-yl)-3-hydroxypropyl]-N'-phenyloxamide.
| Compound Name | N-[(3R)-3-(furan-3-yl)-3-hydroxypropyl]-N'-phenyloxamide |
|---|---|
| PubChem CID | 97106351 |
| Molecular Formula | C15H16N2O4 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | N-[(3R)-3-(furan-3-yl)-3-hydroxypropyl]-N'-phenyloxamide |
| SMILES | O=C(NCC[C@@H](O)c1ccoc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C15H16N2O4/c18-13(11-7-9-21-10-11)6-8-16-14(19)15(20)17-12-4-2-1-3-5-12/h1-5,7,9-10,13,18H,6,8H2,(H,16,19)(H,17,20)/t13-/m1/s1 |
| InChIKey | JHRKIOSFSPYUQS-CYBMUJFWSA-N |
| XLogP | 1.46 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|