C13H20N2O4 — CID 121132914
N-[3-(furan-3-yl)-3-hydroxypropyl]-N'-(2-methylpropyl)oxamide (PubChem CID 121132914) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N-[3-(furan-3-yl)-3-hydroxypropyl]-N'-(2-methylpropyl)oxamide.
| Compound Name | N-[3-(furan-3-yl)-3-hydroxypropyl]-N'-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 121132914 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-[3-(furan-3-yl)-3-hydroxypropyl]-N'-(2-methylpropyl)oxamide |
| SMILES | CC(C)CNC(=O)C(=O)NCCC(O)c1ccoc1 |
| InChI | InChI=1S/C13H20N2O4/c1-9(2)7-15-13(18)12(17)14-5-3-11(16)10-4-6-19-8-10/h4,6,8-9,11,16H,3,5,7H2,1-2H3,(H,14,17)(H,15,18) |
| InChIKey | CEGXQUOIWRCARL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|