C20H20N2O3 — CID 111337528
N-(3-hydroxybutyl)-N'-[3-(2-phenylethynyl)phenyl]oxamide (PubChem CID 111337528) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-N'-[3-(2-phenylethynyl)phenyl]oxamide.
| Compound Name | N-(3-hydroxybutyl)-N'-[3-(2-phenylethynyl)phenyl]oxamide |
|---|---|
| PubChem CID | 111337528 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-(3-hydroxybutyl)-N'-[3-(2-phenylethynyl)phenyl]oxamide |
| SMILES | CC(O)CCNC(=O)C(=O)Nc1cccc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H20N2O3/c1-15(23)12-13-21-19(24)20(25)22-18-9-5-8-17(14-18)11-10-16-6-3-2-4-7-16/h2-9,14-15,23H,12-13H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | OTFQHQAXQADUMK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|