C24H29N3O2 — CID 112825463
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[3-(2-phenylethynyl)phenyl]urea (PubChem CID 112825463) has the molecular formula C24H29N3O2 and a molecular weight of 391.52 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[3-(2-phenylethynyl)phenyl]urea.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[3-(2-phenylethynyl)phenyl]urea |
|---|---|
| PubChem CID | 112825463 |
| Molecular Formula | C24H29N3O2 |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.23 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-3-[3-(2-phenylethynyl)phenyl]urea |
| SMILES | CC1CN(CCCNC(=O)Nc2cccc(C#Cc3ccccc3)c2)CC(C)O1 |
| InChI | InChI=1S/C24H29N3O2/c1-19-17-27(18-20(2)29-19)15-7-14-25-24(28)26-23-11-6-10-22(16-23)13-12-21-8-4-3-5-9-21/h3-6,8-11,16,19-20H,7,14-15,17-18H2,1-2H3,(H2,25,26,28) |
| InChIKey | XJDWLKRKMSXCSF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|