C19H26N2O2 — CID 97039116
N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-3-phenylprop-2-ynamide (PubChem CID 97039116) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-3-phenylprop-2-ynamide.
| Compound Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-3-phenylprop-2-ynamide |
|---|---|
| PubChem CID | 97039116 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]butyl]-3-phenylprop-2-ynamide |
| SMILES | C[C@H]1CN(CCCCNC(=O)C#Cc2ccccc2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H26N2O2/c1-16-14-21(15-17(2)23-16)13-7-6-12-20-19(22)11-10-18-8-4-3-5-9-18/h3-5,8-9,16-17H,6-7,12-15H2,1-2H3,(H,20,22)/t16-,17-/m0/s1 |
| InChIKey | RORMFZFDSSXPDW-IRXDYDNUSA-N |
| XLogP | 2.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|