C18H31Cl2N3O2 — CID 120612238
3-(2-aminophenyl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]propanamide;dihydrochloride (PubChem CID 120612238) has the molecular formula C18H31Cl2N3O2 and a molecular weight of 392.37 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]propanamide;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120612238 |
| Molecular Formula | C18H31Cl2N3O2 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 3-(2-aminophenyl)-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]propanamide;dihydrochloride |
| SMILES | CC1CN(CCCNC(=O)CCc2ccccc2N)CC(C)O1.Cl.Cl |
| InChI | InChI=1S/C18H29N3O2.2ClH/c1-14-12-21(13-15(2)23-14)11-5-10-20-18(22)9-8-16-6-3-4-7-17(16)19;;/h3-4,6-7,14-15H,5,8-13,19H2,1-2H3,(H,20,22);2*1H |
| InChIKey | XRFFKFURCBXFIR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|