C15H33Cl2N3O2 — CID 120564879
4-amino-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]pentanamide;dihydrochloride (PubChem CID 120564879) has the molecular formula C15H33Cl2N3O2 and a molecular weight of 358.35 g/mol. Its IUPAC name is 4-amino-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]pentanamide;dihydrochloride.
| Compound Name | 4-amino-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]pentanamide;dihydrochloride |
|---|---|
| PubChem CID | 120564879 |
| Molecular Formula | C15H33Cl2N3O2 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 4-amino-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]pentanamide;dihydrochloride |
| SMILES | CC(N)CCC(=O)NCCCCN1CC(C)OC(C)C1.Cl.Cl |
| InChI | InChI=1S/C15H31N3O2.2ClH/c1-12(16)6-7-15(19)17-8-4-5-9-18-10-13(2)20-14(3)11-18;;/h12-14H,4-11,16H2,1-3H3,(H,17,19);2*1H |
| InChIKey | FWAZFTXJNOZKDY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|