C11H24N2O — CID 60842262
4-(2,6-dimethylmorpholin-4-yl)-N-methylbutan-1-amine (PubChem CID 60842262) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 4-(2,6-dimethylmorpholin-4-yl)-N-methylbutan-1-amine.
| Compound Name | 4-(2,6-dimethylmorpholin-4-yl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 60842262 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 4-(2,6-dimethylmorpholin-4-yl)-N-methylbutan-1-amine |
| SMILES | CNCCCCN1CC(C)OC(C)C1 |
| InChI | InChI=1S/C11H24N2O/c1-10-8-13(9-11(2)14-10)7-5-4-6-12-3/h10-12H,4-9H2,1-3H3 |
| InChIKey | ZFBCXESPMRSCQE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|