C11H24N2O3S — CID 94181344
N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]ethanesulfonamide (PubChem CID 94181344) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]ethanesulfonamide.
| Compound Name | N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]ethanesulfonamide |
|---|---|
| PubChem CID | 94181344 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N-[3-[(2S,6S)-2,6-dimethylmorpholin-4-yl]propyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCCN1C[C@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C11H24N2O3S/c1-4-17(14,15)12-6-5-7-13-8-10(2)16-11(3)9-13/h10-12H,4-9H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | YMMUGTQWXCNILP-QWRGUYRKSA-N |
| XLogP | 0.43 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|