C11H25IN4O — CID 51131455
1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine;hydroiodide (PubChem CID 51131455) has the molecular formula C11H25IN4O and a molecular weight of 356.25 g/mol. Its IUPAC name is 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 51131455 |
| Molecular Formula | C11H25IN4O |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-[3-(2,6-dimethylmorpholin-4-yl)propyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\N)NCCCN1CC(C)OC(C)C1.I |
| InChI | InChI=1S/C11H24N4O.HI/c1-9-7-15(8-10(2)16-9)6-4-5-14-11(12)13-3;/h9-10H,4-8H2,1-3H3,(H3,12,13,14);1H |
| InChIKey | BZNPVOHQAWKPCQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|