C17H36IN5O2 — CID 111384889
N-tert-butyl-2-[[N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111384889) has the molecular formula C17H36IN5O2 and a molecular weight of 469.41 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-tert-butyl-2-[[N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111384889 |
| Molecular Formula | C17H36IN5O2 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | N-tert-butyl-2-[[N-[3-(2,6-dimethylmorpholin-4-yl)propyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(/NCCCN1CC(C)OC(C)C1)NCC(=O)NC(C)(C)C.I |
| InChI | InChI=1S/C17H35N5O2.HI/c1-13-11-22(12-14(2)24-13)9-7-8-19-16(18-6)20-10-15(23)21-17(3,4)5;/h13-14H,7-12H2,1-6H3,(H,21,23)(H2,18,19,20);1H |
| InChIKey | BRVDYGCPQAJMKP-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|