4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid

C10H21NO4S — CID 9248889

IUPAC4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid
SMILESC[C@@H]1CN(CCCCS(=O)(=O)O)C[C@@H](C)O1
InChIInChI=1S/C10H21NO4S/c1-9-7-11(8-10(2)15-9)5-3-4-6-16(12,13)14/h9-10H,3-8H2,1-2H3,(H,12,13,14)/t9-,10-/m1/s1
InChIKeyWIOFZJARVGMOPD-NXEZZACHSA-N
MW251.35 g/mol
LogP0.76
Rot. Bonds5

About 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid

4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid (PubChem CID 9248889) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid.

Molecular Properties

Compound Name4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid
PubChem CID9248889
Molecular FormulaC10H21NO4S
Molecular Weight251.35 g/mol
Exact Mass251.12
IUPAC Name4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid
SMILESC[C@@H]1CN(CCCCS(=O)(=O)O)C[C@@H](C)O1
InChIInChI=1S/C10H21NO4S/c1-9-7-11(8-10(2)15-9)5-3-4-6-16(12,13)14/h9-10H,3-8H2,1-2H3,(H,12,13,14)/t9-,10-/m1/s1
InChIKeyWIOFZJARVGMOPD-NXEZZACHSA-N
XLogP0.76
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.35
LogP ≤ 50.76
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid?
The IUPAC name of 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid (CID 9248889) is 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid.
What is the SMILES notation for 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid?
The canonical SMILES for 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid is C[C@@H]1CN(CCCCS(=O)(=O)O)C[C@@H](C)O1.
What is the InChIKey of 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid?
The InChIKey is WIOFZJARVGMOPD-NXEZZACHSA-N. The full InChI is InChI=1S/C10H21NO4S/c1-9-7-11(8-10(2)15-9)5-3-4-6-16(12,13)14/h9-10H,3-8H2,1-2H3,(H,12,13,14)/t9-,10-/m1/s1.
What are the key properties of 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid?
4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid has a molecular weight of 251.35 g/mol, XLogP of 0.76, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]butane-1-sulfonic acid is sourced from PubChem (CID 9248889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).