C14H31Cl2N3O2 — CID 119858913
4-amino-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]butanamide;dihydrochloride (PubChem CID 119858913) has the molecular formula C14H31Cl2N3O2 and a molecular weight of 344.33 g/mol. Its IUPAC name is 4-amino-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]butanamide;dihydrochloride.
| Compound Name | 4-amino-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119858913 |
| Molecular Formula | C14H31Cl2N3O2 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 4-amino-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]butanamide;dihydrochloride |
| SMILES | CC1CN(CCCCNC(=O)CCCN)CC(C)O1.Cl.Cl |
| InChI | InChI=1S/C14H29N3O2.2ClH/c1-12-10-17(11-13(2)19-12)9-4-3-8-16-14(18)6-5-7-15;;/h12-13H,3-11,15H2,1-2H3,(H,16,18);2*1H |
| InChIKey | UIOOBOHMDXENAO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|