C15H31Cl2N3O3 — CID 119858903
N-[4-(2,6-dimethylmorpholin-4-yl)butyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 119858903) has the molecular formula C15H31Cl2N3O3 and a molecular weight of 372.34 g/mol. Its IUPAC name is N-[4-(2,6-dimethylmorpholin-4-yl)butyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-[4-(2,6-dimethylmorpholin-4-yl)butyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119858903 |
| Molecular Formula | C15H31Cl2N3O3 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | N-[4-(2,6-dimethylmorpholin-4-yl)butyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | CC1CN(CCCCNC(=O)C2CNCCO2)CC(C)O1.Cl.Cl |
| InChI | InChI=1S/C15H29N3O3.2ClH/c1-12-10-18(11-13(2)21-12)7-4-3-5-17-15(19)14-9-16-6-8-20-14;;/h12-14,16H,3-11H2,1-2H3,(H,17,19);2*1H |
| InChIKey | PBASWKWLCBOYOA-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|