C17H27Cl2N3O2 — CID 119851357
N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]morpholine-2-carboxamide;dihydrochloride (PubChem CID 119851357) has the molecular formula C17H27Cl2N3O2 and a molecular weight of 376.33 g/mol. Its IUPAC name is N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]morpholine-2-carboxamide;dihydrochloride.
| Compound Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]morpholine-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119851357 |
| Molecular Formula | C17H27Cl2N3O2 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[3-(3,4-dihydro-1H-isoquinolin-2-yl)propyl]morpholine-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCN1CCc2ccccc2C1)C1CNCCO1 |
| InChI | InChI=1S/C17H25N3O2.2ClH/c21-17(16-12-18-8-11-22-16)19-7-3-9-20-10-6-14-4-1-2-5-15(14)13-20;;/h1-2,4-5,16,18H,3,6-13H2,(H,19,21);2*1H |
| InChIKey | JFSSQWSWPAUXCR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|