C17H25N3O2 — CID 119994993
N-(3-piperazin-1-ylpropyl)-3,4-dihydro-1H-isochromene-1-carboxamide (PubChem CID 119994993) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-(3-piperazin-1-ylpropyl)-3,4-dihydro-1H-isochromene-1-carboxamide.
| Compound Name | N-(3-piperazin-1-ylpropyl)-3,4-dihydro-1H-isochromene-1-carboxamide |
|---|---|
| PubChem CID | 119994993 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | N-(3-piperazin-1-ylpropyl)-3,4-dihydro-1H-isochromene-1-carboxamide |
| SMILES | O=C(NCCCN1CCNCC1)C1OCCc2ccccc21 |
| InChI | InChI=1S/C17H25N3O2/c21-17(19-7-3-10-20-11-8-18-9-12-20)16-15-5-2-1-4-14(15)6-13-22-16/h1-2,4-5,16,18H,3,6-13H2,(H,19,21) |
| InChIKey | LBDATBRLSNXUET-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|