C18H17NO4 — CID 119994931
4-[(3,4-dihydro-1H-isochromene-1-carbonylamino)methyl]benzoic acid (PubChem CID 119994931) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 4-[(3,4-dihydro-1H-isochromene-1-carbonylamino)methyl]benzoic acid.
| Compound Name | 4-[(3,4-dihydro-1H-isochromene-1-carbonylamino)methyl]benzoic acid |
|---|---|
| PubChem CID | 119994931 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-[(3,4-dihydro-1H-isochromene-1-carbonylamino)methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CNC(=O)C2OCCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H17NO4/c20-17(16-15-4-2-1-3-13(15)9-10-23-16)19-11-12-5-7-14(8-6-12)18(21)22/h1-8,16H,9-11H2,(H,19,20)(H,21,22) |
| InChIKey | CYRWPBZHZBXKHA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |