C17H17NO2 — CID 7343697
(1R)-N-benzyl-3,4-dihydro-1H-isochromene-1-carboxamide (PubChem CID 7343697) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (1R)-N-benzyl-3,4-dihydro-1H-isochromene-1-carboxamide.
| Compound Name | (1R)-N-benzyl-3,4-dihydro-1H-isochromene-1-carboxamide |
|---|---|
| PubChem CID | 7343697 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (1R)-N-benzyl-3,4-dihydro-1H-isochromene-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)[C@@H]1OCCc2ccccc21 |
| InChI | InChI=1S/C17H17NO2/c19-17(18-12-13-6-2-1-3-7-13)16-15-9-5-4-8-14(15)10-11-20-16/h1-9,16H,10-12H2,(H,18,19)/t16-/m1/s1 |
| InChIKey | WJVUFIGGUFQLKW-MRXNPFEDSA-N |
| XLogP | 2.62 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |