C16H33Cl2N3O3 — CID 120798713
(2S,5R)-5-(aminomethyl)-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]oxolane-2-carboxamide;dihydrochloride (PubChem CID 120798713) has the molecular formula C16H33Cl2N3O3 and a molecular weight of 386.36 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]oxolane-2-carboxamide;dihydrochloride.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]oxolane-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120798713 |
| Molecular Formula | C16H33Cl2N3O3 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[4-(2,6-dimethylmorpholin-4-yl)butyl]oxolane-2-carboxamide;dihydrochloride |
| SMILES | CC1CN(CCCCNC(=O)[C@@H]2CC[C@H](CN)O2)CC(C)O1.Cl.Cl |
| InChI | InChI=1S/C16H31N3O3.2ClH/c1-12-10-19(11-13(2)21-12)8-4-3-7-18-16(20)15-6-5-14(9-17)22-15;;/h12-15H,3-11,17H2,1-2H3,(H,18,20);2*1H/t12?,13?,14-,15+;;/m1../s1 |
| InChIKey | VRTLWPLXMANMOP-ZBSNKYDTSA-N |
| XLogP | 1.34 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|